C24H23N3O — CID 58093343
1-(1,2,3,4,5,6-hexahydroazepino[4,5-b]indol-8-yl)-4-(4-methylphenyl)pyridin-2-one (PubChem CID 58093343) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-(1,2,3,4,5,6-hexahydroazepino[4,5-b]indol-8-yl)-4-(4-methylphenyl)pyridin-2-one.
| Compound Name | 1-(1,2,3,4,5,6-hexahydroazepino[4,5-b]indol-8-yl)-4-(4-methylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 58093343 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 1-(1,2,3,4,5,6-hexahydroazepino[4,5-b]indol-8-yl)-4-(4-methylphenyl)pyridin-2-one |
| SMILES | Cc1ccc(-c2ccn(-c3ccc4c5c([nH]c4c3)CCNCC5)c(=O)c2)cc1 |
| InChI | InChI=1S/C24H23N3O/c1-16-2-4-17(5-3-16)18-10-13-27(24(28)14-18)19-6-7-20-21-8-11-25-12-9-22(21)26-23(20)15-19/h2-7,10,13-15,25-26H,8-9,11-12H2,1H3 |
| InChIKey | UFLBHUUIYOINJF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|