C24H22F2N4O2 — CID 58093357
4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one (PubChem CID 58093357) has the molecular formula C24H22F2N4O2 and a molecular weight of 436.46 g/mol. Its IUPAC name is 4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one.
| Compound Name | 4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58093357 |
| Molecular Formula | C24H22F2N4O2 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 4-[(3,5-difluoro-2-pyridinyl)methoxy]-1-(8-methyl-6,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraen-5-yl)pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ncc(F)cc5F)cc4=O)nc31)CCCCC2 |
| InChI | InChI=1S/C24H22F2N4O2/c1-29-21-6-4-2-3-5-17(21)18-7-8-22(28-24(18)29)30-10-9-16(12-23(30)31)32-14-20-19(26)11-15(25)13-27-20/h7-13H,2-6,14H2,1H3 |
| InChIKey | LXOAAPWRQJITGT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |