C24H22FN3O2 — CID 58093435
4-[(5-fluoro-2-pyridinyl)methoxy]-1-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-3-yl)pyridin-2-one (PubChem CID 58093435) has the molecular formula C24H22FN3O2 and a molecular weight of 403.46 g/mol. Its IUPAC name is 4-[(5-fluoro-2-pyridinyl)methoxy]-1-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-3-yl)pyridin-2-one.
| Compound Name | 4-[(5-fluoro-2-pyridinyl)methoxy]-1-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 58093435 |
| Molecular Formula | C24H22FN3O2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 4-[(5-fluoro-2-pyridinyl)methoxy]-1-(5,6,7,8,9,10-hexahydrocyclohepta[b]indol-3-yl)pyridin-2-one |
| SMILES | O=c1cc(OCc2ccc(F)cn2)ccn1-c1ccc2c3c([nH]c2c1)CCCCC3 |
| InChI | InChI=1S/C24H22FN3O2/c25-16-6-7-17(26-14-16)15-30-19-10-11-28(24(29)13-19)18-8-9-21-20-4-2-1-3-5-22(20)27-23(21)12-18/h6-14,27H,1-5,15H2 |
| InChIKey | KNPWYJXEAVRVRW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|