About 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one
6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one (PubChem CID 58093634) has the molecular formula C25H24N4O3
and a molecular weight of 428.49 g/mol. Its IUPAC name is 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one |
| PubChem CID | 58093634 |
| Molecular Formula | C25H24N4O3 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one |
| SMILES | COc1cncc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(C4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C25H24N4O3/c1-31-21-12-19(14-26-15-21)22-13-18-6-9-27-25(30)23(18)24(29-22)28-20-4-2-16(3-5-20)17-7-10-32-11-8-17/h2-6,9,12-15,17H,7-8,10-11H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | ORBHGFHNKDKLIU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one (CID 58093634) is 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one is COc1cncc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(C4CCOCC4)cc3)n2)c1.
What is the InChIKey of 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one?
The InChIKey is ORBHGFHNKDKLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N4O3/c1-31-21-12-19(14-26-15-21)22-13-18-6-9-27-25(30)23(18)24(29-22)28-20-4-2-16(3-5-20)17-7-10-32-11-8-17/h2-6,9,12-15,17H,7-8,10-11H2,1H3,(H,27,30)(H,28,29).
What are the key properties of 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one?
6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one has a molecular weight of 428.49 g/mol, XLogP of 4.63, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-methoxy-3-pyridinyl)-8-[4-(oxan-4-yl)anilino]-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 58093634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).