C24H23N5O3 — CID 58093834
6-(6-amino-3-pyridinyl)-8-[4-(oxan-4-yloxy)anilino]-2H-2,7-naphthyridin-1-one (PubChem CID 58093834) has the molecular formula C24H23N5O3 and a molecular weight of 429.48 g/mol. Its IUPAC name is 6-(6-amino-3-pyridinyl)-8-[4-(oxan-4-yloxy)anilino]-2H-2,7-naphthyridin-1-one.
| Compound Name | 6-(6-amino-3-pyridinyl)-8-[4-(oxan-4-yloxy)anilino]-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 58093834 |
| Molecular Formula | C24H23N5O3 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 6-(6-amino-3-pyridinyl)-8-[4-(oxan-4-yloxy)anilino]-2H-2,7-naphthyridin-1-one |
| SMILES | Nc1ccc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(OC4CCOCC4)cc3)n2)cn1 |
| InChI | InChI=1S/C24H23N5O3/c25-21-6-1-16(14-27-21)20-13-15-7-10-26-24(30)22(15)23(29-20)28-17-2-4-18(5-3-17)32-19-8-11-31-12-9-19/h1-7,10,13-14,19H,8-9,11-12H2,(H2,25,27)(H,26,30)(H,28,29) |
| InChIKey | SUOAFGVEQJKTGC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |