About 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one
8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one (PubChem CID 58094280) has the molecular formula C24H24N6O2
and a molecular weight of 428.50 g/mol. Its IUPAC name is 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one |
| PubChem CID | 58094280 |
| Molecular Formula | C24H24N6O2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2cc(-c3cncnc3)nc(Nc3ccc(CCN4CCOCC4)cc3)c12 |
| InChI | InChI=1S/C24H24N6O2/c31-24-22-18(5-7-27-24)13-21(19-14-25-16-26-15-19)29-23(22)28-20-3-1-17(2-4-20)6-8-30-9-11-32-12-10-30/h1-5,7,13-16H,6,8-12H2,(H,27,31)(H,28,29) |
| InChIKey | NTUXZSHISCRISE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one?
The IUPAC name of 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one (CID 58094280) is 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one is O=c1[nH]ccc2cc(-c3cncnc3)nc(Nc3ccc(CCN4CCOCC4)cc3)c12.
What is the InChIKey of 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one?
The InChIKey is NTUXZSHISCRISE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N6O2/c31-24-22-18(5-7-27-24)13-21(19-14-25-16-26-15-19)29-23(22)28-20-3-1-17(2-4-20)6-8-30-9-11-32-12-10-30/h1-5,7,13-16H,6,8-12H2,(H,27,31)(H,28,29).
What are the key properties of 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one?
8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one has a molecular weight of 428.50 g/mol, XLogP of 3.00, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(2-morpholin-4-ylethyl)anilino]-6-pyrimidin-5-yl-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 58094280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).