About 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one
6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one (PubChem CID 58094538) has the molecular formula C21H17N7O2
and a molecular weight of 399.41 g/mol. Its IUPAC name is 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one |
| PubChem CID | 58094538 |
| Molecular Formula | C21H17N7O2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one |
| SMILES | COc1cncc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc4cn(C)nc4c3)n2)n1 |
| InChI | InChI=1S/C21H17N7O2/c1-28-11-13-3-4-14(8-15(13)27-28)24-20-19-12(5-6-23-21(19)29)7-16(26-20)17-9-22-10-18(25-17)30-2/h3-11H,1-2H3,(H,23,29)(H,24,26) |
| InChIKey | XNTNAPXYNCUXAA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one (CID 58094538) is 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one is COc1cncc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc4cn(C)nc4c3)n2)n1.
What is the InChIKey of 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one?
The InChIKey is XNTNAPXYNCUXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N7O2/c1-28-11-13-3-4-14(8-15(13)27-28)24-20-19-12(5-6-23-21(19)29)7-16(26-20)17-9-22-10-18(25-17)30-2/h3-11H,1-2H3,(H,23,29)(H,24,26).
What are the key properties of 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one?
6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one has a molecular weight of 399.41 g/mol, XLogP of 3.02, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-methoxypyrazin-2-yl)-8-[(2-methylindazol-6-yl)amino]-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 58094538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).