About 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one
6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one (PubChem CID 58094659) has the molecular formula C23H24N6O
and a molecular weight of 400.49 g/mol. Its IUPAC name is 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| PubChem CID | 58094659 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one |
| SMILES | Cn1cc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(C4CCNCC4)cc3)n2)cn1 |
| InChI | InChI=1S/C23H24N6O/c1-29-14-18(13-26-29)20-12-17-8-11-25-23(30)21(17)22(28-20)27-19-4-2-15(3-5-19)16-6-9-24-10-7-16/h2-5,8,11-14,16,24H,6-7,9-10H2,1H3,(H,25,30)(H,27,28) |
| InChIKey | GOMDSIDLUWNXGN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
The IUPAC name of 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one (CID 58094659) is 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one is Cn1cc(-c2cc3cc[nH]c(=O)c3c(Nc3ccc(C4CCNCC4)cc3)n2)cn1.
What is the InChIKey of 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
The InChIKey is GOMDSIDLUWNXGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N6O/c1-29-14-18(13-26-29)20-12-17-8-11-25-23(30)21(17)22(28-20)27-19-4-2-15(3-5-19)16-6-9-24-10-7-16/h2-5,8,11-14,16,24H,6-7,9-10H2,1H3,(H,25,30)(H,27,28).
What are the key properties of 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one?
6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one has a molecular weight of 400.49 g/mol, XLogP of 3.53, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-methylpyrazol-4-yl)-8-(4-piperidin-4-ylanilino)-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 58094659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).