C20H11Cl2FN6OS — CID 58094735
N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-5-fluoro-2-pyridinyl]acetamide (PubChem CID 58094735) has the molecular formula C20H11Cl2FN6OS and a molecular weight of 473.32 g/mol. Its IUPAC name is N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-5-fluoro-2-pyridinyl]acetamide.
| Compound Name | N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-5-fluoro-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 58094735 |
| Molecular Formula | C20H11Cl2FN6OS |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | N-[4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-5-fluoro-2-pyridinyl]acetamide |
| SMILES | [C-]#[N+]c1c(-c2cc(NC(C)=O)ncc2F)sc(-c2ncn[nH]2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H11Cl2FN6OS/c1-9(30)28-15-6-12(14(23)7-25-15)18-17(24-2)16(11-4-3-10(21)5-13(11)22)19(31-18)20-26-8-27-29-20/h3-8H,1H3,(H,25,28,30)(H,26,27,29) |
| InChIKey | SAVUTVRHPFGAGE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|