C23H23N7S — CID 58094911
4-[2-methyl-3-[4-phenyl-5-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]butan-1-amine (PubChem CID 58094911) has the molecular formula C23H23N7S and a molecular weight of 429.55 g/mol. Its IUPAC name is 4-[2-methyl-3-[4-phenyl-5-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]butan-1-amine.
| Compound Name | 4-[2-methyl-3-[4-phenyl-5-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]butan-1-amine |
|---|---|
| PubChem CID | 58094911 |
| Molecular Formula | C23H23N7S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[2-methyl-3-[4-phenyl-5-(1H-1,2,4-triazol-5-yl)-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]butan-1-amine |
| SMILES | Cc1nc2ccc(CCCCN)cn2c1-c1nc(-c2ccccc2)c(-c2ncn[nH]2)s1 |
| InChI | InChI=1S/C23H23N7S/c1-15-20(30-13-16(7-5-6-12-24)10-11-18(30)27-15)23-28-19(17-8-3-2-4-9-17)21(31-23)22-25-14-26-29-22/h2-4,8-11,13-14H,5-7,12,24H2,1H3,(H,25,26,29) |
| InChIKey | SWDJCGXEMYCVEA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|