About 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine
4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine (PubChem CID 58095055) has the molecular formula C11H10FNS
and a molecular weight of 207.27 g/mol. Its IUPAC name is 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine.
Molecular Properties
| Compound Name | 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine |
| PubChem CID | 58095055 |
| Molecular Formula | C11H10FNS |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine |
| SMILES | Cc1cc(-c2ccnc(F)c2)sc1C |
| InChI | InChI=1S/C11H10FNS/c1-7-5-10(14-8(7)2)9-3-4-13-11(12)6-9/h3-6H,1-2H3 |
| InChIKey | ALRRFQINZSELLQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine?
The IUPAC name of 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine (CID 58095055) is 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine.
What is the SMILES notation for 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine?
The canonical SMILES for 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine is Cc1cc(-c2ccnc(F)c2)sc1C.
What is the InChIKey of 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine?
The InChIKey is ALRRFQINZSELLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNS/c1-7-5-10(14-8(7)2)9-3-4-13-11(12)6-9/h3-6H,1-2H3.
What are the key properties of 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine?
4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine has a molecular weight of 207.27 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethylthiophen-2-yl)-2-fluoropyridine is sourced from PubChem (CID 58095055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).