C26H26N6O3S — CID 58095116
1-[2-methyl-3-[5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]ethane-1,2-diol (PubChem CID 58095116) has the molecular formula C26H26N6O3S and a molecular weight of 502.60 g/mol. Its IUPAC name is 1-[2-methyl-3-[5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]ethane-1,2-diol.
| Compound Name | 1-[2-methyl-3-[5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 58095116 |
| Molecular Formula | C26H26N6O3S |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 1-[2-methyl-3-[5-[1-(oxan-2-yl)-1,2,4-triazol-3-yl]-4-phenyl-1,3-thiazol-2-yl]imidazo[1,2-a]pyridin-6-yl]ethane-1,2-diol |
| SMILES | Cc1nc2ccc(C(O)CO)cn2c1-c1nc(-c2ccccc2)c(-c2ncn(C3CCCCO3)n2)s1 |
| InChI | InChI=1S/C26H26N6O3S/c1-16-23(31-13-18(19(34)14-33)10-11-20(31)28-16)26-29-22(17-7-3-2-4-8-17)24(36-26)25-27-15-32(30-25)21-9-5-6-12-35-21/h2-4,7-8,10-11,13,15,19,21,33-34H,5-6,9,12,14H2,1H3 |
| InChIKey | DBWYBBWJRNZMKJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |