C18H8Cl2FN5S — CID 58095181
4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine (PubChem CID 58095181) has the molecular formula C18H8Cl2FN5S and a molecular weight of 416.27 g/mol. Its IUPAC name is 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine.
| Compound Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine |
|---|---|
| PubChem CID | 58095181 |
| Molecular Formula | C18H8Cl2FN5S |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 4-[4-(2,4-dichlorophenyl)-3-isocyano-5-(1H-1,2,4-triazol-5-yl)thiophen-2-yl]-2-fluoropyridine |
| SMILES | [C-]#[N+]c1c(-c2ccnc(F)c2)sc(-c2ncn[nH]2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H8Cl2FN5S/c1-22-15-14(11-3-2-10(19)7-12(11)20)17(18-24-8-25-26-18)27-16(15)9-4-5-23-13(21)6-9/h2-8H,(H,24,25,26) |
| InChIKey | NDWSOEXDWJCFOO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 58.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|