C7H13NO — CID 58095387
(3aR)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 58095387) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is (3aR)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (3aR)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 58095387 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | (3aR)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | CN1CC2OCC[C@@H]2C1 |
| InChI | InChI=1S/C7H13NO/c1-8-4-6-2-3-9-7(6)5-8/h6-7H,2-5H2,1H3/t6-,7?/m1/s1 |
| InChIKey | QYSWLGHPQFYIQO-ULUSZKPHSA-N |
| XLogP | 0.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |