About (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane
(3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane (PubChem CID 58095518) has the molecular formula C10H21NS
and a molecular weight of 187.35 g/mol. Its IUPAC name is (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane.
Molecular Properties
| Compound Name | (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane |
| PubChem CID | 58095518 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane |
| SMILES | C=S1CCN(C(C)(C)C)[C@H](C)C1 |
| InChI | InChI=1S/C10H21NS/c1-9-8-12(5)7-6-11(9)10(2,3)4/h9H,5-8H2,1-4H3/t9-,12?/m1/s1 |
| InChIKey | BUVLCVXANUEJAU-PKEIRNPWSA-N |
| XLogP | 2.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane?
The IUPAC name of (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane (CID 58095518) is (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane.
What is the SMILES notation for (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane?
The canonical SMILES for (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane is C=S1CCN(C(C)(C)C)[C@H](C)C1.
What is the InChIKey of (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane?
The InChIKey is BUVLCVXANUEJAU-PKEIRNPWSA-N. The full InChI is InChI=1S/C10H21NS/c1-9-8-12(5)7-6-11(9)10(2,3)4/h9H,5-8H2,1-4H3/t9-,12?/m1/s1.
What are the key properties of (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane?
(3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane has a molecular weight of 187.35 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-tert-butyl-3-methyl-1-methylidene-1,4-thiazinane is sourced from PubChem (CID 58095518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).