C5H12N2 — CID 58095725
3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanimidamide (PubChem CID 58095725) has the molecular formula C5H12N2 and a molecular weight of 109.22 g/mol. Its IUPAC name is 3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanimidamide.
| Compound Name | 3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanimidamide |
|---|---|
| PubChem CID | 58095725 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 109.22 g/mol |
| Exact Mass | 109.16 |
| IUPAC Name | 3,3,3-trideuterio-2,2-bis(trideuteriomethyl)propanimidamide |
| SMILES | [H]/N=C(\N)C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C5H12N2/c1-5(2,3)4(6)7/h1-3H3,(H3,6,7)/i1D3,2D3,3D3 |
| InChIKey | FNHMJTUQUPQWJN-GQALSZNTSA-N |
| XLogP | 0.97 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|