About 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine
2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 58095783) has the molecular formula C9H12N6
and a molecular weight of 204.24 g/mol. Its IUPAC name is 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
| PubChem CID | 58095783 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CN1CCn2c(ccc2-c2nn[nH]n2)C1 |
| InChI | InChI=1S/C9H12N6/c1-14-4-5-15-7(6-14)2-3-8(15)9-10-12-13-11-9/h2-3H,4-6H2,1H3,(H,10,11,12,13) |
| InChIKey | MPHPITOYGLPDRT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
The IUPAC name of 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine (CID 58095783) is 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
The canonical SMILES for 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine is CN1CCn2c(ccc2-c2nn[nH]n2)C1.
What is the InChIKey of 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
The InChIKey is MPHPITOYGLPDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6/c1-14-4-5-15-7(6-14)2-3-8(15)9-10-12-13-11-9/h2-3H,4-6H2,1H3,(H,10,11,12,13).
What are the key properties of 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine?
2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine has a molecular weight of 204.24 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(2H-tetrazol-5-yl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 58095783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).