About 1,2,6-trimethyl-3,4-dihydrocinnoline
1,2,6-trimethyl-3,4-dihydrocinnoline (PubChem CID 58095805) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,2,6-trimethyl-3,4-dihydrocinnoline.
Molecular Properties
| Compound Name | 1,2,6-trimethyl-3,4-dihydrocinnoline |
| PubChem CID | 58095805 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1,2,6-trimethyl-3,4-dihydrocinnoline |
| SMILES | Cc1ccc2c(c1)CCN(C)N2C |
| InChI | InChI=1S/C11H16N2/c1-9-4-5-11-10(8-9)6-7-12(2)13(11)3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | IRIIVZCHACYZQW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2,6-trimethyl-3,4-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,6-trimethyl-3,4-dihydrocinnoline?
The IUPAC name of 1,2,6-trimethyl-3,4-dihydrocinnoline (CID 58095805) is 1,2,6-trimethyl-3,4-dihydrocinnoline.
What is the SMILES notation for 1,2,6-trimethyl-3,4-dihydrocinnoline?
The canonical SMILES for 1,2,6-trimethyl-3,4-dihydrocinnoline is Cc1ccc2c(c1)CCN(C)N2C.
What is the InChIKey of 1,2,6-trimethyl-3,4-dihydrocinnoline?
The InChIKey is IRIIVZCHACYZQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-9-4-5-11-10(8-9)6-7-12(2)13(11)3/h4-5,8H,6-7H2,1-3H3.
What are the key properties of 1,2,6-trimethyl-3,4-dihydrocinnoline?
1,2,6-trimethyl-3,4-dihydrocinnoline has a molecular weight of 176.26 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,6-trimethyl-3,4-dihydrocinnoline is sourced from PubChem (CID 58095805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).