About 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine
2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 58095828) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
Analyze 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The IUPAC name of 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (CID 58095828) is 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
What is the SMILES notation for 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The canonical SMILES for 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is Cc1cn2c(n1)C(C)N(C)CC2.
What is the InChIKey of 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The InChIKey is WDSXSVIEMDTQSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3/c1-7-6-12-5-4-11(3)8(2)9(12)10-7/h6,8H,4-5H2,1-3H3.
What are the key properties of 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine has a molecular weight of 165.24 g/mol, XLogP of 1.20, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7,8-trimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is sourced from PubChem (CID 58095828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).