About 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine
6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine (PubChem CID 58095862) has the molecular formula C8H11BrN2S
and a molecular weight of 247.16 g/mol. Its IUPAC name is 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine.
Molecular Properties
| Compound Name | 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine |
| PubChem CID | 58095862 |
| Molecular Formula | C8H11BrN2S |
| Molecular Weight | 247.16 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine |
| SMILES | CN1CCc2sc(Br)cc2N1C |
| InChI | InChI=1S/C8H11BrN2S/c1-10-4-3-7-6(11(10)2)5-8(9)12-7/h5H,3-4H2,1-2H3 |
| InChIKey | YJSKOCGLOIKJED-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine?
The IUPAC name of 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine (CID 58095862) is 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine.
What is the SMILES notation for 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine?
The canonical SMILES for 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine is CN1CCc2sc(Br)cc2N1C.
What is the InChIKey of 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine?
The InChIKey is YJSKOCGLOIKJED-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2S/c1-10-4-3-7-6(11(10)2)5-8(9)12-7/h5H,3-4H2,1-2H3.
What are the key properties of 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine?
6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine has a molecular weight of 247.16 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,2-dimethyl-3,4-dihydrothieno[3,2-c]pyridazine is sourced from PubChem (CID 58095862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).