About 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine
1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine (PubChem CID 58095872) has the molecular formula C7H12N4
and a molecular weight of 152.20 g/mol. Its IUPAC name is 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine.
Analyze 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine?
The IUPAC name of 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine (CID 58095872) is 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine.
What is the SMILES notation for 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine?
The canonical SMILES for 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine is CN1CCn2ccnc2N1C.
What is the InChIKey of 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine?
The InChIKey is IPXRNVJDZWFJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4/c1-9-5-6-11-4-3-8-7(11)10(9)2/h3-4H,5-6H2,1-2H3.
What are the key properties of 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine?
1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine has a molecular weight of 152.20 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3,4-dihydroimidazo[2,1-c][1,2,4]triazine is sourced from PubChem (CID 58095872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).