About [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate
[3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate (PubChem CID 58096318) has the molecular formula C18H19N4O4S+
and a molecular weight of 387.44 g/mol. Its IUPAC name is [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate.
Molecular Properties
| Compound Name | [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate |
| PubChem CID | 58096318 |
| Molecular Formula | C18H19N4O4S+ |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate |
| SMILES | Cc1cc(OCC[n+]2ccc(N)cc2)cc(OS(=O)(=O)c2ccncn2)c1 |
| InChI | InChI=1S/C18H18N4O4S/c1-14-10-16(25-9-8-22-6-3-15(19)4-7-22)12-17(11-14)26-27(23,24)18-2-5-20-13-21-18/h2-7,10-13,19H,8-9H2,1H3/p+1 |
| InChIKey | XSQLYTJGQPZNEM-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate?
The IUPAC name of [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate (CID 58096318) is [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate.
What is the SMILES notation for [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate?
The canonical SMILES for [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate is Cc1cc(OCC[n+]2ccc(N)cc2)cc(OS(=O)(=O)c2ccncn2)c1.
What is the InChIKey of [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate?
The InChIKey is XSQLYTJGQPZNEM-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H18N4O4S/c1-14-10-16(25-9-8-22-6-3-15(19)4-7-22)12-17(11-14)26-27(23,24)18-2-5-20-13-21-18/h2-7,10-13,19H,8-9H2,1H3/p+1.
What are the key properties of [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate?
[3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate has a molecular weight of 387.44 g/mol, XLogP of 1.50, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[2-(4-aminopyridin-1-ium-1-yl)ethoxy]-5-methylphenyl] pyrimidine-4-sulfonate is sourced from PubChem (CID 58096318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).