C20H36O6 — CID 58096391
4-[(2R,4S,5R)-4-acetyloxy-6-ethyl-3,5-dimethyloxan-2-yl]oxybutyl 2,2-dimethylpropanoate (PubChem CID 58096391) has the molecular formula C20H36O6 and a molecular weight of 372.50 g/mol. Its IUPAC name is 4-[(2R,4S,5R)-4-acetyloxy-6-ethyl-3,5-dimethyloxan-2-yl]oxybutyl 2,2-dimethylpropanoate.
| Compound Name | 4-[(2R,4S,5R)-4-acetyloxy-6-ethyl-3,5-dimethyloxan-2-yl]oxybutyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58096391 |
| Molecular Formula | C20H36O6 |
| Molecular Weight | 372.50 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 4-[(2R,4S,5R)-4-acetyloxy-6-ethyl-3,5-dimethyloxan-2-yl]oxybutyl 2,2-dimethylpropanoate |
| SMILES | CCC1O[C@@H](OCCCCOC(=O)C(C)(C)C)C(C)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C20H36O6/c1-8-16-13(2)17(25-15(4)21)14(3)18(26-16)23-11-9-10-12-24-19(22)20(5,6)7/h13-14,16-18H,8-12H2,1-7H3/t13-,14?,16?,17+,18-/m1/s1 |
| InChIKey | SQZINDBICHUTHE-IMXXYGAVSA-N |
| XLogP | 3.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|