About [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate
[2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate (PubChem CID 58096614) has the molecular formula C30H33N3O4
and a molecular weight of 499.61 g/mol. Its IUPAC name is [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate.
Molecular Properties
| Compound Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate |
| PubChem CID | 58096614 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OCn1c(=O)oc2c(N3CCN(Cc4cccc(-c5ccccc5)c4)CC3)cccc21 |
| InChI | InChI=1S/C30H33N3O4/c1-2-3-15-28(34)36-22-33-27-14-8-13-26(29(27)37-30(33)35)32-18-16-31(17-19-32)21-23-9-7-12-25(20-23)24-10-5-4-6-11-24/h4-14,20H,2-3,15-19,21-22H2,1H3 |
| InChIKey | SNXUBMHRSZMUJT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate?
The IUPAC name of [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate (CID 58096614) is [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate.
What is the SMILES notation for [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate?
The canonical SMILES for [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate is CCCCC(=O)OCn1c(=O)oc2c(N3CCN(Cc4cccc(-c5ccccc5)c4)CC3)cccc21.
What is the InChIKey of [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate?
The InChIKey is SNXUBMHRSZMUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H33N3O4/c1-2-3-15-28(34)36-22-33-27-14-8-13-26(29(27)37-30(33)35)32-18-16-31(17-19-32)21-23-9-7-12-25(20-23)24-10-5-4-6-11-24/h4-14,20H,2-3,15-19,21-22H2,1H3.
What are the key properties of [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate?
[2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate has a molecular weight of 499.61 g/mol, XLogP of 5.27, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl pentanoate is sourced from PubChem (CID 58096614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).