About 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate
2,4-dimethylpentan-3-yl N,N-dihexylcarbamate (PubChem CID 58096615) has the molecular formula C20H41NO2
and a molecular weight of 327.55 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate |
| PubChem CID | 58096615 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate |
| SMILES | CCCCCCN(CCCCCC)C(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C20H41NO2/c1-7-9-11-13-15-21(16-14-12-10-8-2)20(22)23-19(17(3)4)18(5)6/h17-19H,7-16H2,1-6H3 |
| InChIKey | RDWOIUWCFHMKGE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate?
The IUPAC name of 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate (CID 58096615) is 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate.
What is the SMILES notation for 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate?
The canonical SMILES for 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate is CCCCCCN(CCCCCC)C(=O)OC(C(C)C)C(C)C.
What is the InChIKey of 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate?
The InChIKey is RDWOIUWCFHMKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41NO2/c1-7-9-11-13-15-21(16-14-12-10-8-2)20(22)23-19(17(3)4)18(5)6/h17-19H,7-16H2,1-6H3.
What are the key properties of 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate?
2,4-dimethylpentan-3-yl N,N-dihexylcarbamate has a molecular weight of 327.55 g/mol, XLogP of 6.27, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-3-yl N,N-dihexylcarbamate is sourced from PubChem (CID 58096615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).