C43H53N3O4 — CID 58096685
[2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 58096685) has the molecular formula C43H53N3O4 and a molecular weight of 675.91 g/mol. Its IUPAC name is [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 58096685 |
| Molecular Formula | C43H53N3O4 |
| Molecular Weight | 675.91 g/mol |
| Exact Mass | 675.40 |
| IUPAC Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OCn1c(=O)oc2c(N3CCN(Cc4cccc(-c5ccccc5)c4)CC3)cccc21 |
| InChI | InChI=1S/C43H53N3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-28-41(47)49-35-46-40-27-21-26-39(42(40)50-43(46)48)45-31-29-44(30-32-45)34-36-22-20-25-38(33-36)37-23-17-16-18-24-37/h3-4,6-7,9-10,16-18,20-27,33H,2,5,8,11-15,19,28-32,34-35H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | OONQGAWCSNWJMZ-PDBXOOCHSA-N |
| XLogP | 9.67 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.91 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|