C46H55N3O4 — CID 58096724
[2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoate (PubChem CID 58096724) has the molecular formula C46H55N3O4 and a molecular weight of 713.96 g/mol. Its IUPAC name is [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoate.
| Compound Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoate |
|---|---|
| PubChem CID | 58096724 |
| Molecular Formula | C46H55N3O4 |
| Molecular Weight | 713.96 g/mol |
| Exact Mass | 713.42 |
| IUPAC Name | [2-oxo-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-1,3-benzoxazol-3-yl]methyl (5Z,8Z,11Z,14Z,17Z)-henicosa-5,8,11,14,17-pentaenoate |
| SMILES | CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCn1c(=O)oc2c(N3CCN(Cc4cccc(-c5ccccc5)c4)CC3)cccc21 |
| InChI | InChI=1S/C46H55N3O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-31-44(50)52-38-49-43-30-24-29-42(45(43)53-46(49)51)48-34-32-47(33-35-48)37-39-25-23-28-41(36-39)40-26-20-19-21-27-40/h4-5,7-8,10-11,13-14,16-17,19-21,23-30,36H,2-3,6,9,12,15,18,22,31-35,37-38H2,1H3/b5-4-,8-7-,11-10-,14-13-,17-16- |
| InChIKey | YMOCDISHOKWFGO-JEBPEJKESA-N |
| XLogP | 10.40 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.96 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|