C29H44O4 — CID 58096738
(1-ethoxy-3-methyl-1-oxobutan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 58096738) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is (1-ethoxy-3-methyl-1-oxobutan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 58096738 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(C(=O)OCC)C(C)C |
| InChI | InChI=1S/C29H44O4/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-27(30)33-28(26(3)4)29(31)32-6-2/h7-8,10-11,13-14,16-17,19-20,22-23,26,28H,5-6,9,12,15,18,21,24-25H2,1-4H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | DOPUGHZQOJRLGK-XTJKPUCJSA-N |
| XLogP | 7.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|