C27H44O4 — CID 58096749
(1-ethoxy-3-methyl-1-oxobutan-2-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate (PubChem CID 58096749) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (1-ethoxy-3-methyl-1-oxobutan-2-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate.
| Compound Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 58096749 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (1-ethoxy-3-methyl-1-oxobutan-2-yl) (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OC(C(=O)OCC)C(C)C |
| InChI | InChI=1S/C27H44O4/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25(28)31-26(24(3)4)27(29)30-6-2/h10-11,13-14,16-17,19-20,24,26H,5-9,12,15,18,21-23H2,1-4H3/b11-10-,14-13-,17-16-,20-19- |
| InChIKey | WHTWHASDGFWRMV-AILJCPQKSA-N |
| XLogP | 7.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|