About 3-methylbutan-2-yl N,N-dihexylcarbamate
3-methylbutan-2-yl N,N-dihexylcarbamate (PubChem CID 58096797) has the molecular formula C18H37NO2
and a molecular weight of 299.50 g/mol. Its IUPAC name is 3-methylbutan-2-yl N,N-dihexylcarbamate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl N,N-dihexylcarbamate |
| PubChem CID | 58096797 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 3-methylbutan-2-yl N,N-dihexylcarbamate |
| SMILES | CCCCCCN(CCCCCC)C(=O)OC(C)C(C)C |
| InChI | InChI=1S/C18H37NO2/c1-6-8-10-12-14-19(15-13-11-9-7-2)18(20)21-17(5)16(3)4/h16-17H,6-15H2,1-5H3 |
| InChIKey | PXNQIWXNCGDVAJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutan-2-yl N,N-dihexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl N,N-dihexylcarbamate?
The IUPAC name of 3-methylbutan-2-yl N,N-dihexylcarbamate (CID 58096797) is 3-methylbutan-2-yl N,N-dihexylcarbamate.
What is the SMILES notation for 3-methylbutan-2-yl N,N-dihexylcarbamate?
The canonical SMILES for 3-methylbutan-2-yl N,N-dihexylcarbamate is CCCCCCN(CCCCCC)C(=O)OC(C)C(C)C.
What is the InChIKey of 3-methylbutan-2-yl N,N-dihexylcarbamate?
The InChIKey is PXNQIWXNCGDVAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37NO2/c1-6-8-10-12-14-19(15-13-11-9-7-2)18(20)21-17(5)16(3)4/h16-17H,6-15H2,1-5H3.
What are the key properties of 3-methylbutan-2-yl N,N-dihexylcarbamate?
3-methylbutan-2-yl N,N-dihexylcarbamate has a molecular weight of 299.50 g/mol, XLogP of 5.63, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl N,N-dihexylcarbamate is sourced from PubChem (CID 58096797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).