C29H46O2 — CID 58096862
2,4-dimethylpentan-3-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 58096862) has the molecular formula C29H46O2 and a molecular weight of 426.69 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | 2,4-dimethylpentan-3-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 58096862 |
| Molecular Formula | C29H46O2 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.35 |
| IUPAC Name | 2,4-dimethylpentan-3-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C29H46O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-28(30)31-29(26(2)3)27(4)5/h7-8,10-11,13-14,16-17,19-20,22-23,26-27,29H,6,9,12,15,18,21,24-25H2,1-5H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | PDXHEFAOZBAVFL-XTJKPUCJSA-N |
| XLogP | 8.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|