About [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate
[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate (PubChem CID 58097392) has the molecular formula C5H7N2O4S-
and a molecular weight of 191.19 g/mol. Its IUPAC name is [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate.
Molecular Properties
| Compound Name | [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate |
| PubChem CID | 58097392 |
| Molecular Formula | C5H7N2O4S- |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate |
| SMILES | C[C@]1(CS(=O)[O-])NC(=O)NC1=O |
| InChI | InChI=1S/C5H8N2O4S/c1-5(2-12(10)11)3(8)6-4(9)7-5/h2H2,1H3,(H,10,11)(H2,6,7,8,9)/p-1/t5-/m1/s1 |
| InChIKey | XTWCXDYRXCDABZ-RXMQYKEDSA-M |
| XLogP | -1.54 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate?
The IUPAC name of [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate (CID 58097392) is [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate.
What is the SMILES notation for [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate?
The canonical SMILES for [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate is C[C@]1(CS(=O)[O-])NC(=O)NC1=O.
What is the InChIKey of [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate?
The InChIKey is XTWCXDYRXCDABZ-RXMQYKEDSA-M. The full InChI is InChI=1S/C5H8N2O4S/c1-5(2-12(10)11)3(8)6-4(9)7-5/h2H2,1H3,(H,10,11)(H2,6,7,8,9)/p-1/t5-/m1/s1.
What are the key properties of [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate?
[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate has a molecular weight of 191.19 g/mol, XLogP of -1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]methanesulfinate is sourced from PubChem (CID 58097392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).