About (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium)
(2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) (PubChem CID 58097660) has the molecular formula C6H10O7Y2
and a molecular weight of 371.95 g/mol. Its IUPAC name is (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium).
Molecular Properties
| Compound Name | (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) |
| PubChem CID | 58097660 |
| Molecular Formula | C6H10O7Y2 |
| Molecular Weight | 371.95 g/mol |
| Exact Mass | 371.85 |
| IUPAC Name | (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) |
| SMILES | COCC(O)(OC=O)C(O)OC=O.[Y].[Y] |
| InChI | InChI=1S/C6H10O7.2Y/c1-11-2-6(10,13-4-8)5(9)12-3-7;;/h3-5,9-10H,2H2,1H3;; |
| InChIKey | JJRLLPZZEHVNIP-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.95 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium)?
The IUPAC name of (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) (CID 58097660) is (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium).
What is the SMILES notation for (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium)?
The canonical SMILES for (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) is COCC(O)(OC=O)C(O)OC=O.[Y].[Y].
What is the InChIKey of (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium)?
The InChIKey is JJRLLPZZEHVNIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O7.2Y/c1-11-2-6(10,13-4-8)5(9)12-3-7;;/h3-5,9-10H,2H2,1H3;;.
What are the key properties of (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium)?
(2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) has a molecular weight of 371.95 g/mol, XLogP of -2.02, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formyloxy-1,2-dihydroxy-3-methoxypropyl) formate;bis(yttrium) is sourced from PubChem (CID 58097660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).