C35H68N2O5 — CID 58097712
bis[2,2,6,6-tetramethyl-1-(2,4,4-trimethylpentoxy)piperidin-4-yl] carbonate (PubChem CID 58097712) has the molecular formula C35H68N2O5 and a molecular weight of 596.94 g/mol. Its IUPAC name is bis[2,2,6,6-tetramethyl-1-(2,4,4-trimethylpentoxy)piperidin-4-yl] carbonate.
| Compound Name | bis[2,2,6,6-tetramethyl-1-(2,4,4-trimethylpentoxy)piperidin-4-yl] carbonate |
|---|---|
| PubChem CID | 58097712 |
| Molecular Formula | C35H68N2O5 |
| Molecular Weight | 596.94 g/mol |
| Exact Mass | 596.51 |
| IUPAC Name | bis[2,2,6,6-tetramethyl-1-(2,4,4-trimethylpentoxy)piperidin-4-yl] carbonate |
| SMILES | CC(CON1C(C)(C)CC(OC(=O)OC2CC(C)(C)N(OCC(C)CC(C)(C)C)C(C)(C)C2)CC1(C)C)CC(C)(C)C |
| InChI | InChI=1S/C35H68N2O5/c1-25(17-30(3,4)5)23-39-36-32(9,10)19-27(20-33(36,11)12)41-29(38)42-28-21-34(13,14)37(35(15,16)22-28)40-24-26(2)18-31(6,7)8/h25-28H,17-24H2,1-16H3 |
| InChIKey | KWIDGSRVJVTSNN-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.94 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |