C14H19N3O4P2S — CID 58097838
(6S,7R,8aR)-7-azido-2-(2-methyldiphosphanyl)-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol (PubChem CID 58097838) has the molecular formula C14H19N3O4P2S and a molecular weight of 387.34 g/mol. Its IUPAC name is (6S,7R,8aR)-7-azido-2-(2-methyldiphosphanyl)-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol.
| Compound Name | (6S,7R,8aR)-7-azido-2-(2-methyldiphosphanyl)-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
|---|---|
| PubChem CID | 58097838 |
| Molecular Formula | C14H19N3O4P2S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | (6S,7R,8aR)-7-azido-2-(2-methyldiphosphanyl)-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-ol |
| SMILES | CPPC1OCC2O[C@@H](Sc3ccccc3)[C@H](N=[N+]=[N-])C(O)[C@H]2O1 |
| InChI | InChI=1S/C14H19N3O4P2S/c1-22-23-14-19-7-9-12(21-14)11(18)10(16-17-15)13(20-9)24-8-5-3-2-4-6-8/h2-6,9-14,18,22-23H,7H2,1H3/t9?,10-,11?,12+,13+,14?/m1/s1 |
| InChIKey | NDTRPDQJFIZOBE-AYIIYHCTSA-N |
| XLogP | 3.14 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|