C12H17NO4S — CID 58097840
(3R,5R,6S)-5-amino-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol (PubChem CID 58097840) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (3R,5R,6S)-5-amino-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol.
| Compound Name | (3R,5R,6S)-5-amino-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol |
|---|---|
| PubChem CID | 58097840 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (3R,5R,6S)-5-amino-2-(hydroxymethyl)-6-phenylsulfanyloxane-3,4-diol |
| SMILES | N[C@@H]1C(O)[C@@H](O)C(CO)O[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C12H17NO4S/c13-9-11(16)10(15)8(6-14)17-12(9)18-7-4-2-1-3-5-7/h1-5,8-12,14-16H,6,13H2/t8?,9-,10+,11?,12+/m1/s1 |
| InChIKey | HBKCCHZPHWSVCQ-ZVCXTHFISA-N |
| XLogP | -0.46 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |