About (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol
(1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol (PubChem CID 58098334) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol.
Molecular Properties
| Compound Name | (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol |
| PubChem CID | 58098334 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol |
| SMILES | O[C@@H]1c2ccccc2C=C[C@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H15NO/c20-18-13-6-2-1-5-12(13)9-10-15(18)16-11-19-17-8-4-3-7-14(16)17/h1-11,15,18-20H/t15-,18+/m0/s1 |
| InChIKey | NUNGRSHZZMEKGW-MAUKXSAKSA-N |
| XLogP | 4.01 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol?
The IUPAC name of (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol (CID 58098334) is (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol.
What is the SMILES notation for (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol?
The canonical SMILES for (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol is O[C@@H]1c2ccccc2C=C[C@H]1c1c[nH]c2ccccc12.
What is the InChIKey of (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol?
The InChIKey is NUNGRSHZZMEKGW-MAUKXSAKSA-N. The full InChI is InChI=1S/C18H15NO/c20-18-13-6-2-1-5-12(13)9-10-15(18)16-11-19-17-8-4-3-7-14(16)17/h1-11,15,18-20H/t15-,18+/m0/s1.
What are the key properties of (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol?
(1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol has a molecular weight of 261.32 g/mol, XLogP of 4.01, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-(1H-indol-3-yl)-1,2-dihydronaphthalen-1-ol is sourced from PubChem (CID 58098334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).