C23H30NO2P — CID 58098354
tert-butyl (2S,4S)-2-(diphenylphosphanylmethyl)-4-methylpyrrolidine-1-carboxylate (PubChem CID 58098354) has the molecular formula C23H30NO2P and a molecular weight of 383.47 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(diphenylphosphanylmethyl)-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-(diphenylphosphanylmethyl)-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58098354 |
| Molecular Formula | C23H30NO2P |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | tert-butyl (2S,4S)-2-(diphenylphosphanylmethyl)-4-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](CP(c2ccccc2)c2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H30NO2P/c1-18-15-19(24(16-18)22(25)26-23(2,3)4)17-27(20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,18-19H,15-17H2,1-4H3/t18-,19-/m0/s1 |
| InChIKey | VYVDLHIXINBCQM-OALUTQOASA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|