C60H46F10N2Si2 — CID 58099431
1-N,6-N-bis[2,4-difluoro-5-[3-(trifluoromethyl)phenyl]phenyl]-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine (PubChem CID 58099431) has the molecular formula C60H46F10N2Si2 and a molecular weight of 1041.19 g/mol. Its IUPAC name is 1-N,6-N-bis[2,4-difluoro-5-[3-(trifluoromethyl)phenyl]phenyl]-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine.
| Compound Name | 1-N,6-N-bis[2,4-difluoro-5-[3-(trifluoromethyl)phenyl]phenyl]-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
|---|---|
| PubChem CID | 58099431 |
| Molecular Formula | C60H46F10N2Si2 |
| Molecular Weight | 1041.19 g/mol |
| Exact Mass | 1040.30 |
| IUPAC Name | 1-N,6-N-bis[2,4-difluoro-5-[3-(trifluoromethyl)phenyl]phenyl]-1-N,6-N-bis(4-trimethylsilylphenyl)pyrene-1,6-diamine |
| SMILES | C[Si](C)(C)c1ccc(N(c2cc(-c3cccc(C(F)(F)F)c3)c(F)cc2F)c2ccc3ccc4c(N(c5ccc([Si](C)(C)C)cc5)c5cc(-c6cccc(C(F)(F)F)c6)c(F)cc5F)ccc5ccc2c3c54)cc1 |
| InChI | InChI=1S/C60H46F10N2Si2/c1-73(2,3)43-21-17-41(18-22-43)71(55-31-47(49(61)33-51(55)63)37-9-7-11-39(29-37)59(65,66)67)53-27-15-35-14-26-46-54(28-16-36-13-25-45(53)57(35)58(36)46)72(42-19-23-44(24-20-42)74(4,5)6)56-32-48(50(62)34-52(56)64)38-10-8-12-40(30-38)60(68,69)70/h7-34H,1-6H3 |
| InChIKey | XNCKNINXGQLYPP-UHFFFAOYSA-N |
| XLogP | 18.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1041.19 |
| LogP ≤ 5 | 18.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|