C9H14N4O2 — CID 58099721
1,3,8,9-tetramethyl-4,5-dihydropurine-2,6-dione (PubChem CID 58099721) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 1,3,8,9-tetramethyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 1,3,8,9-tetramethyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 58099721 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1,3,8,9-tetramethyl-4,5-dihydropurine-2,6-dione |
| SMILES | CC1=NC2C(=O)N(C)C(=O)N(C)C2N1C |
| InChI | InChI=1S/C9H14N4O2/c1-5-10-6-7(11(5)2)12(3)9(15)13(4)8(6)14/h6-7H,1-4H3 |
| InChIKey | JSWCMLJAMMIJQY-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |