C52H36IrN5OS- — CID 58099796
9-[2-(1-dibenzofuran-2-yl-2,5-dimethylimidazol-4-yl)-8-(3,5-dimethyl-1-phenylpyrazol-4-yl)dibenzothiophen-4-yl]carbazole;iridium (PubChem CID 58099796) has the molecular formula C52H36IrN5OS- and a molecular weight of 971.18 g/mol. Its IUPAC name is 9-[2-(1-dibenzofuran-2-yl-2,5-dimethylimidazol-4-yl)-8-(3,5-dimethyl-1-phenylpyrazol-4-yl)dibenzothiophen-4-yl]carbazole;iridium.
| Compound Name | 9-[2-(1-dibenzofuran-2-yl-2,5-dimethylimidazol-4-yl)-8-(3,5-dimethyl-1-phenylpyrazol-4-yl)dibenzothiophen-4-yl]carbazole;iridium |
|---|---|
| PubChem CID | 58099796 |
| Molecular Formula | C52H36IrN5OS- |
| Molecular Weight | 971.18 g/mol |
| Exact Mass | 971.23 |
| IUPAC Name | 9-[2-(1-dibenzofuran-2-yl-2,5-dimethylimidazol-4-yl)-8-(3,5-dimethyl-1-phenylpyrazol-4-yl)dibenzothiophen-4-yl]carbazole;iridium |
| SMILES | Cc1nn(-c2[c-]cccc2)c(C)c1-c1ccc2sc3c(-n4c5ccccc5c5ccccc54)cc(-c4nc(C)n(-c5ccc6oc7ccccc7c6c5)c4C)cc3c2c1.[Ir] |
| InChI | InChI=1S/C52H36N5OS.Ir/c1-30-50(31(2)57(54-30)36-14-6-5-7-15-36)34-22-25-49-42(26-34)43-27-35(28-46(52(43)59-49)56-44-19-11-8-16-38(44)39-17-9-12-20-45(39)56)51-32(3)55(33(4)53-51)37-23-24-48-41(29-37)40-18-10-13-21-47(40)58-48;/h5-14,16-29H,1-4H3;/q-1; |
| InChIKey | OCEKTHFWFFUYNM-UHFFFAOYSA-N |
| XLogP | 13.79 |
| TPSA | 53.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.18 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|