About benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium
benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium (PubChem CID 58099935) has the molecular formula C19H28N2O3Y-2
and a molecular weight of 421.35 g/mol. Its IUPAC name is benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium.
Molecular Properties
| Compound Name | benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium |
| PubChem CID | 58099935 |
| Molecular Formula | C19H28N2O3Y-2 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium |
| SMILES | [CH2-]CC(CC)NC(=O)NC(CCC(C)=O)C(C)=O.[Y].[c-]1ccccc1 |
| InChI | InChI=1S/C13H23N2O3.C6H5.Y/c1-5-11(6-2)14-13(18)15-12(10(4)17)8-7-9(3)16;1-2-4-6-5-3-1;/h11-12H,1,5-8H2,2-4H3,(H2,14,15,18);1-5H;/q2*-1; |
| InChIKey | YIBLFVBWBSXCPD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium?
The IUPAC name of benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium (CID 58099935) is benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium.
What is the SMILES notation for benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium?
The canonical SMILES for benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium is [CH2-]CC(CC)NC(=O)NC(CCC(C)=O)C(C)=O.[Y].[c-]1ccccc1.
What is the InChIKey of benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium?
The InChIKey is YIBLFVBWBSXCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N2O3.C6H5.Y/c1-5-11(6-2)14-13(18)15-12(10(4)17)8-7-9(3)16;1-2-4-6-5-3-1;/h11-12H,1,5-8H2,2-4H3,(H2,14,15,18);1-5H;/q2*-1;.
What are the key properties of benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium?
benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium has a molecular weight of 421.35 g/mol, XLogP of 3.10, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-(2,6-dioxoheptan-3-yl)-3-pentan-3-ylurea;yttrium is sourced from PubChem (CID 58099935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).