C14H17F13 — CID 58100020
1,1,1,2,2,4,4,6,6,8,8,10,10-tridecafluoro-12-methyltridecane (PubChem CID 58100020) has the molecular formula C14H17F13 and a molecular weight of 432.26 g/mol. Its IUPAC name is 1,1,1,2,2,4,4,6,6,8,8,10,10-tridecafluoro-12-methyltridecane.
| Compound Name | 1,1,1,2,2,4,4,6,6,8,8,10,10-tridecafluoro-12-methyltridecane |
|---|---|
| PubChem CID | 58100020 |
| Molecular Formula | C14H17F13 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1,1,1,2,2,4,4,6,6,8,8,10,10-tridecafluoro-12-methyltridecane |
| SMILES | CC(C)CC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H17F13/c1-8(2)3-9(15,16)4-10(17,18)5-11(19,20)6-12(21,22)7-13(23,24)14(25,26)27/h8H,3-7H2,1-2H3 |
| InChIKey | MSNQIKHUGLCFMC-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|