C31H41ClN7O5S- — CID 58100070
2-[5-[(1S)-7-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]-1-hydroxyheptyl]-2-hydroxyphenyl]ethanesulfinate (PubChem CID 58100070) has the molecular formula C31H41ClN7O5S- and a molecular weight of 659.23 g/mol. Its IUPAC name is 2-[5-[(1S)-7-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]-1-hydroxyheptyl]-2-hydroxyphenyl]ethanesulfinate.
| Compound Name | 2-[5-[(1S)-7-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]-1-hydroxyheptyl]-2-hydroxyphenyl]ethanesulfinate |
|---|---|
| PubChem CID | 58100070 |
| Molecular Formula | C31H41ClN7O5S- |
| Molecular Weight | 659.23 g/mol |
| Exact Mass | 658.26 |
| IUPAC Name | 2-[5-[(1S)-7-[4-[4-[[amino-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]methylidene]amino]butyl]phenyl]-1-hydroxyheptyl]-2-hydroxyphenyl]ethanesulfinate |
| SMILES | N/C(=N\CCCCc1ccc(CCCCCC[C@H](O)c2ccc(O)c(CCS(=O)[O-])c2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C31H42ClN7O5S/c32-27-29(34)38-28(33)26(37-27)30(42)39-31(35)36-17-6-5-8-21-12-10-20(11-13-21)7-3-1-2-4-9-24(40)22-14-15-25(41)23(19-22)16-18-45(43)44/h10-15,19,24,40-41H,1-9,16-18H2,(H,43,44)(H4,33,34,38)(H3,35,36,39,42)/p-1/t24-/m0/s1 |
| InChIKey | IXVUZFNNGOAAJT-DEOSSOPVSA-M |
| XLogP | 3.72 |
| TPSA | 225.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|