C32H42ClN7O4 — CID 58100084
3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxoethyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 58100084) has the molecular formula C32H42ClN7O4 and a molecular weight of 624.19 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxoethyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxoethyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58100084 |
| Molecular Formula | C32H42ClN7O4 |
| Molecular Weight | 624.19 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxoethyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | C[C@H](CCCc1ccc(CCCC/N=C(\N)NC(=O)c2nc(Cl)c(N)nc2N)cc1)CC[C@H](O)c1ccc(O)c(CC=O)c1 |
| InChI | InChI=1S/C32H42ClN7O4/c1-20(8-14-25(42)23-13-15-26(43)24(19-23)16-18-41)5-4-7-22-11-9-21(10-12-22)6-2-3-17-37-32(36)40-31(44)27-29(34)39-30(35)28(33)38-27/h9-13,15,18-20,25,42-43H,2-8,14,16-17H2,1H3,(H4,34,35,39)(H3,36,37,40,44)/t20-,25+/m1/s1 |
| InChIKey | AGGBXFSTKQMOCQ-NLFFAJNJSA-N |
| XLogP | 4.28 |
| TPSA | 202.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.19 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|