C31H42ClN7O4 — CID 58100115
3,5-diamino-6-chloro-N-[N'-[4-[4-[(7S)-7-hydroxy-7-[4-hydroxy-3-(methoxymethyl)phenyl]heptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 58100115) has the molecular formula C31H42ClN7O4 and a molecular weight of 612.18 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(7S)-7-hydroxy-7-[4-hydroxy-3-(methoxymethyl)phenyl]heptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(7S)-7-hydroxy-7-[4-hydroxy-3-(methoxymethyl)phenyl]heptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58100115 |
| Molecular Formula | C31H42ClN7O4 |
| Molecular Weight | 612.18 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(7S)-7-hydroxy-7-[4-hydroxy-3-(methoxymethyl)phenyl]heptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | COCc1cc([C@@H](O)CCCCCCc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)ccc1O |
| InChI | InChI=1S/C31H42ClN7O4/c1-43-19-23-18-22(15-16-25(23)41)24(40)10-5-3-2-4-8-20-11-13-21(14-12-20)9-6-7-17-36-31(35)39-30(42)26-28(33)38-29(34)27(32)37-26/h11-16,18,24,40-41H,2-10,17,19H2,1H3,(H4,33,34,38)(H3,35,36,39,42)/t24-/m0/s1 |
| InChIKey | RDFIUXRHHLLWJU-DEOSSOPVSA-N |
| XLogP | 4.44 |
| TPSA | 194.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.18 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|