About 3,4,5-trimethoxy-2,6-dimethylheptane
3,4,5-trimethoxy-2,6-dimethylheptane (PubChem CID 58100186) has the molecular formula C12H26O3
and a molecular weight of 218.34 g/mol. Its IUPAC name is 3,4,5-trimethoxy-2,6-dimethylheptane.
Molecular Properties
| Compound Name | 3,4,5-trimethoxy-2,6-dimethylheptane |
| PubChem CID | 58100186 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | 3,4,5-trimethoxy-2,6-dimethylheptane |
| SMILES | COC(C(C)C)C(OC)C(OC)C(C)C |
| InChI | InChI=1S/C12H26O3/c1-8(2)10(13-5)12(15-7)11(14-6)9(3)4/h8-12H,1-7H3 |
| InChIKey | IYFDHNPHFFESFQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4,5-trimethoxy-2,6-dimethylheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-trimethoxy-2,6-dimethylheptane?
The IUPAC name of 3,4,5-trimethoxy-2,6-dimethylheptane (CID 58100186) is 3,4,5-trimethoxy-2,6-dimethylheptane.
What is the SMILES notation for 3,4,5-trimethoxy-2,6-dimethylheptane?
The canonical SMILES for 3,4,5-trimethoxy-2,6-dimethylheptane is COC(C(C)C)C(OC)C(OC)C(C)C.
What is the InChIKey of 3,4,5-trimethoxy-2,6-dimethylheptane?
The InChIKey is IYFDHNPHFFESFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3/c1-8(2)10(13-5)12(15-7)11(14-6)9(3)4/h8-12H,1-7H3.
What are the key properties of 3,4,5-trimethoxy-2,6-dimethylheptane?
3,4,5-trimethoxy-2,6-dimethylheptane has a molecular weight of 218.34 g/mol, XLogP of 2.34, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-trimethoxy-2,6-dimethylheptane is sourced from PubChem (CID 58100186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).