About 3,8-dimethoxy-2,9-dimethyldecane
3,8-dimethoxy-2,9-dimethyldecane (PubChem CID 58100189) has the molecular formula C14H30O2
and a molecular weight of 230.39 g/mol. Its IUPAC name is 3,8-dimethoxy-2,9-dimethyldecane.
Molecular Properties
| Compound Name | 3,8-dimethoxy-2,9-dimethyldecane |
| PubChem CID | 58100189 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 3,8-dimethoxy-2,9-dimethyldecane |
| SMILES | COC(CCCCC(OC)C(C)C)C(C)C |
| InChI | InChI=1S/C14H30O2/c1-11(2)13(15-5)9-7-8-10-14(16-6)12(3)4/h11-14H,7-10H2,1-6H3 |
| InChIKey | ZZQLXJWIDFUVDW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dimethoxy-2,9-dimethyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethoxy-2,9-dimethyldecane?
The IUPAC name of 3,8-dimethoxy-2,9-dimethyldecane (CID 58100189) is 3,8-dimethoxy-2,9-dimethyldecane.
What is the SMILES notation for 3,8-dimethoxy-2,9-dimethyldecane?
The canonical SMILES for 3,8-dimethoxy-2,9-dimethyldecane is COC(CCCCC(OC)C(C)C)C(C)C.
What is the InChIKey of 3,8-dimethoxy-2,9-dimethyldecane?
The InChIKey is ZZQLXJWIDFUVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O2/c1-11(2)13(15-5)9-7-8-10-14(16-6)12(3)4/h11-14H,7-10H2,1-6H3.
What are the key properties of 3,8-dimethoxy-2,9-dimethyldecane?
3,8-dimethoxy-2,9-dimethyldecane has a molecular weight of 230.39 g/mol, XLogP of 3.89, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethoxy-2,9-dimethyldecane is sourced from PubChem (CID 58100189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).