C29H29N3O3 — CID 58100377
(18R)-18-[(dimethylamino)methyl]-17-oxa-14,21-diazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione (PubChem CID 58100377) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is (18R)-18-[(dimethylamino)methyl]-17-oxa-14,21-diazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione.
| Compound Name | (18R)-18-[(dimethylamino)methyl]-17-oxa-14,21-diazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione |
|---|---|
| PubChem CID | 58100377 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (18R)-18-[(dimethylamino)methyl]-17-oxa-14,21-diazahexacyclo[19.6.1.17,14.02,6.08,13.022,27]nonacosa-1(28),2(6),7(29),8,10,12,22,24,26-nonaene-3,5-dione |
| SMILES | CN(C)C[C@H]1CCn2cc(c3ccccc32)C2=C(C(=O)CC2=O)c2cn(c3ccccc23)CCO1 |
| InChI | InChI=1S/C29H29N3O3/c1-30(2)16-19-11-12-31-17-22(20-7-3-5-9-24(20)31)28-26(33)15-27(34)29(28)23-18-32(13-14-35-19)25-10-6-4-8-21(23)25/h3-10,17-19H,11-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | JLCQZBZSCAYDDE-LJQANCHMSA-N |
| XLogP | 4.40 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|