C38H43NO3 — CID 58100386
2-[2,6-di(propan-2-yl)phenyl]-6-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]benzo[de]isoquinoline-1,3-dione (PubChem CID 58100386) has the molecular formula C38H43NO3 and a molecular weight of 561.77 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)phenyl]-6-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[2,6-di(propan-2-yl)phenyl]-6-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 58100386 |
| Molecular Formula | C38H43NO3 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)phenyl]-6-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]benzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)c2cccc3c(Oc4ccc(C(C)(C)CC(C)(C)C)cc4)ccc(c23)C1=O |
| InChI | InChI=1S/C38H43NO3/c1-23(2)27-12-10-13-28(24(3)4)34(27)39-35(40)30-15-11-14-29-32(21-20-31(33(29)30)36(39)41)42-26-18-16-25(17-19-26)38(8,9)22-37(5,6)7/h10-21,23-24H,22H2,1-9H3 |
| InChIKey | HLYXVMWDKPFROM-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|